Nitromalonaldehyde
Catalog No: FT-0695186
CAS No: 34461-00-2
- Chemical Name: Nitromalonaldehyde
- Molecular Formula: C3H2NNaO4
- Molecular Weight: 139.04 g/mol
- InChI Key: OQMLJRMYSFKMDS-UHFFFAOYSA-M
- InChI: InChI=1S/C3H3NO4.Na/c5-1-3(2-6)4(7)8;/h1-2,5H;/q;+1/p-1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 139.04200 |
| Density: | 1.363g/cm3 |
| CAS: | 34461-00-2 |
| Bolling_Point: | 150.1ºC at 760 mmHg |
| Product_Name: | nitromalonaldehyde sodium |
| Melting_Point: | 120-124ºC |
| Flash_Point: | 53.9ºC |
| MF: | C3H2NNaO4 |
| Density: | 1.363g/cm3 |
|---|---|
| Flash_Point: | 53.9ºC |
| Melting_Point: | 120-124ºC |
| FW: | 139.04200 |
| PSA: | 85.95000 |
| Exact_Mass: | 138.98800 |
| MF: | C3H2NNaO4 |
| Bolling_Point: | 150.1ºC at 760 mmHg |
| Refractive_Index: | 1.432 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|---|
| Hazard_Codes: | F;C |
| Risk_Statements(EU): | R11;R14;R18;R19;R20/21/22;R34 |
| Safety_Statements: | S16-S26-S33-S36/37/39-S45 |
| Symbol: | Danger |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| Supplementary_Hazard_Statement: | In use may form flammable/explosive vapour-air mixture., May form explosive peroxides., Reacts violently with water. |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2914190090 |
Related Products
5,5'-Diamino-3,3,3',3'-tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol